Products 1184750-47-7
CAS 1184750-47-7 is the registry number for (4,5-Dichloro-1H-pyrrol-2-yl)(4-(hydroxymethyl)piperidin-1-yl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4,5-dichloro-1H-pyrrol-2-yl)-[4-(hydroxymethyl)piperidin-1-yl]methanone (CAS 1184750-47-7) is a chemical compound with the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.14 g/mol. IUPAC name: (4,5-dichloro-1H-pyrrol-2-yl)-[4-(hydroxymethyl)piperidin-1-yl]methanone. InChIKey: WVWWOFSIPXXNJC-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O2 |
|---|---|
| Molecular weight | 277.14 g/mol |
| IUPAC name | (4,5-dichloro-1H-pyrrol-2-yl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| InChIKey | WVWWOFSIPXXNJC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CO)C(=O)C2=CC(=C(N2)Cl)Cl |
Computed by PubChem (NCBI)