Products 1000781-12-3
CAS 1000781-12-3 appears in our catalog under these names: 2,8-Dimethylchroman-4-one, 98%, 2,8-Dimethylchroman-4-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,8-dimethyl-2,3-dihydrochromen-4-one (CAS 1000781-12-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: SVSBVZVZXRPSFE-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | SVSBVZVZXRPSFE-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=CC=CC(=C2O1)C |
Computed by PubChem (NCBI)