CAS 1000930-23-3 is the registry number for 2-Chloro-N-((3,4-dichlorophenyl)methyl)-N-methylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide (CAS 1000930-23-3) is a chemical compound with the molecular formula C10H10Cl3NO and a molecular weight of 266.5 g/mol. IUPAC name: 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide. InChIKey: JTEJWTRZRUWVFT-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3NO |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide |
| InChIKey | JTEJWTRZRUWVFT-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=C(C=C1)Cl)Cl)C(=O)CCl |
Computed by PubChem (NCBI)