Products 1452295-74-7
CAS 1452295-74-7 is the registry number for (2E)-1-(2,4,6-Trichlorophenyl)-2-propanone O-Methyloxime. Offered by: TRC. Available pack sizes: 100mg, 2,5mg, 25mg.
(E)-N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-imine (CAS 1452295-74-7) is a chemical compound with the molecular formula C10H10Cl3NO and a molecular weight of 266.5 g/mol. IUPAC name: (E)-N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-imine. InChIKey: ONALTRORXRRIQR-MKMNVTDBSA-N.
| Molecular formula | C10H10Cl3NO |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | (E)-N-methoxy-1-(2,4,6-trichlorophenyl)propan-2-imine |
| InChIKey | ONALTRORXRRIQR-MKMNVTDBSA-N |
| SMILES | C/C(=N\OC)/CC1=C(C=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)