CAS 1184409-03-7 appears in our catalog under these names: 2-Chloro-N-((3,5-dichlorophenyl)methyl)-N-methylacetamide, 95%, 2-Chloro-N-((3,5-dichlorophenyl)methyl)-N-methylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylacetamide (CAS 1184409-03-7) is a chemical compound with the molecular formula C10H10Cl3NO and a molecular weight of 266.5 g/mol. IUPAC name: 2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylacetamide. InChIKey: IHXUALQEZXKETO-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3NO |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | 2-chloro-N-[(3,5-dichlorophenyl)methyl]-N-methylacetamide |
| InChIKey | IHXUALQEZXKETO-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC(=C1)Cl)Cl)C(=O)CCl |
Computed by PubChem (NCBI)