CAS 34162-21-5 is the registry number for 2-Chloro-N-(2-(2,3-dichlorophenyl)ethyl)acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-[2-(2,3-dichlorophenyl)ethyl]acetamide (CAS 34162-21-5) is a chemical compound with the molecular formula C10H10Cl3NO and a molecular weight of 266.5 g/mol. IUPAC name: 2-chloro-N-[2-(2,3-dichlorophenyl)ethyl]acetamide. InChIKey: KXZSDDDWTOHUAM-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3NO |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | 2-chloro-N-[2-(2,3-dichlorophenyl)ethyl]acetamide |
| InChIKey | KXZSDDDWTOHUAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CCNC(=O)CCl |
Computed by PubChem (NCBI)