CAS 1346672-30-7 is the registry number for 2,2,2-Trichloro-1-(4,5,6,7-tetrahydro-1h-indol-2-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2,2-trichloro-1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethanone (CAS 1346672-30-7) is a chemical compound with the molecular formula C10H10Cl3NO and a molecular weight of 266.5 g/mol. IUPAC name: 2,2,2-trichloro-1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethanone. InChIKey: NNFGBZPUPIKCAT-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3NO |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(4,5,6,7-tetrahydro-1H-indol-2-yl)ethanone |
| InChIKey | NNFGBZPUPIKCAT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(N2)C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)