Products 1000932-54-6

CAS 1000932-54-6 is the registry number for 4-(Cyclopropylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(cyclopropylsulfamoyl)benzenesulfonyl chloride (CAS 1000932-54-6) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 4-(cyclopropylsulfamoyl)benzenesulfonyl chloride. InChIKey: IKRLTAZGFZYUGS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO4S2
Molecular weight295.8 g/mol
IUPAC name4-(cyclopropylsulfamoyl)benzenesulfonyl chloride
InChIKeyIKRLTAZGFZYUGS-UHFFFAOYSA-N
SMILESC1CC1NS(=O)(=O)C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)