CAS 1007999-30-5 appears in our catalog under these names: 1-[(5-Chlorothien-2-yl)sulfonyl]pyrrolidine-2-carboxylic acid, 95%, 1-((5-CHlorothien-2-yl)sulfonyl)pyrrolidine-2-carboxylic acid, 98%, 1-((5-Chloro-2-thienyl)sulfonyl)proline/ 99.59% (existing batch purity), 1-[(5-Chlorothien-2-yl)sulfonyl]pyrrolidine-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, TargetMol, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1007999-30-5) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: UYVXUYVAIIWBSW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S2 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | UYVXUYVAIIWBSW-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=C(S2)Cl)C(=O)O |
Computed by PubChem (NCBI)