Products 1837420-77-5
CAS 1837420-77-5 is the registry number for 1-((5-Chlorothiophen-2-yl)sulfonyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-3-carboxylic acid (CAS 1837420-77-5) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-3-carboxylic acid. InChIKey: LHSPQSAYANWHCQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S2 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-3-carboxylic acid |
| InChIKey | LHSPQSAYANWHCQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)S(=O)(=O)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)