CAS 1307962-30-6 is the registry number for 2-(Cyclopropylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(cyclopropylsulfamoyl)benzenesulfonyl chloride (CAS 1307962-30-6) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 2-(cyclopropylsulfamoyl)benzenesulfonyl chloride. InChIKey: NCVRESVVUMRVMK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S2 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-(cyclopropylsulfamoyl)benzenesulfonyl chloride |
| InChIKey | NCVRESVVUMRVMK-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)