Products 1307962-30-6

CAS 1307962-30-6 is the registry number for 2-(Cyclopropylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(cyclopropylsulfamoyl)benzenesulfonyl chloride (CAS 1307962-30-6) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 2-(cyclopropylsulfamoyl)benzenesulfonyl chloride. InChIKey: NCVRESVVUMRVMK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO4S2
Molecular weight295.8 g/mol
IUPAC name2-(cyclopropylsulfamoyl)benzenesulfonyl chloride
InChIKeyNCVRESVVUMRVMK-UHFFFAOYSA-N
SMILESC1CC1NS(=O)(=O)C2=CC=CC=C2S(=O)(=O)Cl

Computed by PubChem (NCBI)