CAS 1240529-01-4 is the registry number for 4-(1,1-Dioxo-1,2-thiazolidin-2-yl)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzenesulfonyl chloride (CAS 1240529-01-4) is a chemical compound with the molecular formula C9H10ClNO4S2 and a molecular weight of 295.8 g/mol. IUPAC name: 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzenesulfonyl chloride. InChIKey: NBMRNUHOCZZUFW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S2 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzenesulfonyl chloride |
| InChIKey | NBMRNUHOCZZUFW-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)