Products 100127-15-9
CAS 100127-15-9 is the registry number for 1-(2,5-Dichlorophenyl)-3-(dimethylamino)propan-1-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,5-dichlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride (CAS 100127-15-9) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride. InChIKey: ISJPQNPHKHMRME-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride |
| InChIKey | ISJPQNPHKHMRME-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)C1=C(C=CC(=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)