CAS 1220033-11-3 appears in our catalog under these names: 3-((2,4-Dichlorobenzyl)oxy)pyrrolidine hydrochloride 95%, 3-((2,4-DICHLOROBENZYL)OXY)PYRROLIDINE HCL, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(2,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride (CAS 1220033-11-3) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 3-[(2,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride. InChIKey: GGNMWLWPDGQZSC-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride |
| InChIKey | GGNMWLWPDGQZSC-UHFFFAOYSA-N |
| SMILES | C1CNCC1OCC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)