Products 2748344-06-9
CAS 2748344-06-9 is the registry number for 1-(3,4-Dichlorophenyl)-2-(dimethylamino)-1-propanone (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
1-(3,4-dichlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride (CAS 2748344-06-9) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride. InChIKey: YZLUDTMQXDYUBC-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride |
| InChIKey | YZLUDTMQXDYUBC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)Cl)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)