CAS 1261234-83-6 is the registry number for (R)-3-((3,4-Dichlorobenzyl)oxy)pyrrolidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(3R)-3-[(3,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride (CAS 1261234-83-6) is a chemical compound with the molecular formula C11H14Cl3NO and a molecular weight of 282.6 g/mol. IUPAC name: (3R)-3-[(3,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride. InChIKey: GMMIBHGNIHSRSY-SBSPUUFOSA-N.
| Molecular formula | C11H14Cl3NO |
|---|---|
| Molecular weight | 282.6 g/mol |
| IUPAC name | (3R)-3-[(3,4-dichlorophenyl)methoxy]pyrrolidine;hydrochloride |
| InChIKey | GMMIBHGNIHSRSY-SBSPUUFOSA-N |
| SMILES | C1CNC[C@@H]1OCC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)