Products 100129-69-9

CAS 100129-69-9 is the registry number for Methyl 2-tert-butyl-6-chloropyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-tert-butyl-6-chloropyridine-4-carboxylate (CAS 100129-69-9) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 2-tert-butyl-6-chloropyridine-4-carboxylate. InChIKey: SACWINYAICXFNG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2
Molecular weight227.69 g/mol
IUPAC namemethyl 2-tert-butyl-6-chloropyridine-4-carboxylate
InChIKeySACWINYAICXFNG-UHFFFAOYSA-N
SMILESCC(C)(C)C1=NC(=CC(=C1)C(=O)OC)Cl

Computed by PubChem (NCBI)