Products 100142-87-8
CAS 100142-87-8 appears in our catalog under these names: hCAI/II/XII-IN-1, 4'-amino-[1,1'-biphenyl]-4-sulfonamide, ≥97%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 250mg, 1g, 5g, 10g.
4-(4-aminophenyl)benzenesulfonamide (CAS 100142-87-8) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 4-(4-aminophenyl)benzenesulfonamide. InChIKey: OFWFFDCOBHXZME-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 4-(4-aminophenyl)benzenesulfonamide |
| InChIKey | OFWFFDCOBHXZME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)N)N |
Computed by PubChem (NCBI)