CAS 100145-14-0 is the registry number for rel-(1R,3S)-2,2-Dimethyl-3-(2-oxopropyl)cyclopropaneacetic acid. Offered by: TRC. Available pack sizes: 500mg.
2-[3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid (CAS 100145-14-0) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 2-[3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid. InChIKey: SHAQRECSQXZUMW-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-[3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid |
| InChIKey | SHAQRECSQXZUMW-UHFFFAOYSA-N |
| SMILES | CC1(C(C1CC(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)