Products 66407-16-7
CAS 66407-16-7 is the registry number for Cis-3,3-Dimethyl-1,2-Cyclopropanediacetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-[(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid (CAS 66407-16-7) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 2-[(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid. InChIKey: SHAQRECSQXZUMW-OLQVQODUSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-[(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropyl]acetic acid |
| InChIKey | SHAQRECSQXZUMW-OLQVQODUSA-N |
| SMILES | CC1([C@@H]([C@@H]1CC(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)