CAS 1002517-60-3 is the registry number for 3-Cyano-N-(4-methylthiazol-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-N-(4-methyl-1,3-thiazol-2-yl)benzamide (CAS 1002517-60-3) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: 3-cyano-N-(4-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: RXWYJGLYQKXERX-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 3-cyano-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | RXWYJGLYQKXERX-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)