CAS 27106-16-7 appears in our catalog under these names: 5-Furan-2-yl-4-phenyl-4h-[1,2,4]triazole-3-thiol, 95%, 5-(Furan-2-yl)-4-phenyl-4H-1,2,4-triazole-3-thiol, 97%, 5-(Furan-2-yl)-4-phenyl-4H-1,2,4-triazole-3-thiol, 3-(furan-2-yl)-4-phenyl-4,5-dihydro-1H-1,2,4-triazole-5-thione, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(furan-2-yl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 27106-16-7) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: 3-(furan-2-yl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: CNWLGJLWFORSRE-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 3-(furan-2-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | CNWLGJLWFORSRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=CO3 |
Computed by PubChem (NCBI)