CAS 941868-52-6 appears in our catalog under these names: 2-Methyl-7-phenyl[1,3]thiazolo[4,5-d]pyridazin-4(5h)-one, 95%, 2-Methyl-7-phenyl(1,3)thiazolo(4,5-d)pyridazin-4(5H)-one, 98%, 2-Methyl-7-phenyl-4H,5H-(1,3)thiazolo(4,5-d)pyridazin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one (CAS 941868-52-6) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: 2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one. InChIKey: HQXKZACFHBMHSG-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 2-methyl-7-phenyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| InChIKey | HQXKZACFHBMHSG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=NNC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)