CAS 306280-98-8 appears in our catalog under these names: 3-Amino-5-phenyl-3h-thieno[2,3-d]pyrimidin-4-one, 95%, 3-Amino-5-phenyl-thieno(2,3-d)pyrimidin-4(3H)-one, 3-Amino-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%, 3-Amino-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-amino-5-phenylthieno[2,3-d]pyrimidin-4-one (CAS 306280-98-8) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: 3-amino-5-phenylthieno[2,3-d]pyrimidin-4-one. InChIKey: GAEPLNQOHWWKDK-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 3-amino-5-phenylthieno[2,3-d]pyrimidin-4-one |
| InChIKey | GAEPLNQOHWWKDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)N(C=N3)N |
Computed by PubChem (NCBI)