CAS 1154705-08-4 is the registry number for 3-[5-(Thiophen-2-yl)-1,2,4-oxadiazol-3-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)aniline (CAS 1154705-08-4) is a chemical compound with the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. IUPAC name: 3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)aniline. InChIKey: CGVUEUBCUNYEAU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3OS |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | 3-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)aniline |
| InChIKey | CGVUEUBCUNYEAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NOC(=N2)C3=CC=CS3 |
Computed by PubChem (NCBI)