CAS 1002752-56-8 is the registry number for Benzonitrile, 3-[(1S,2S)-2-amino-1-[(4-chlorophenyl)methyl]propyl]-, 2,2,2-trifluoroacetate (1:1), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-amino-1-(4-chlorophenyl)butan-2-yl]benzonitrile (CAS 1002752-56-8) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: 3-[3-amino-1-(4-chlorophenyl)butan-2-yl]benzonitrile. InChIKey: DUGNQLMMMIZIFR-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2 |
|---|---|
| Molecular weight | 284.8 g/mol |
| IUPAC name | 3-[3-amino-1-(4-chlorophenyl)butan-2-yl]benzonitrile |
| InChIKey | DUGNQLMMMIZIFR-UHFFFAOYSA-N |
| SMILES | CC(C(CC1=CC=C(C=C1)Cl)C2=CC=CC(=C2)C#N)N |
Computed by PubChem (NCBI)