CAS 13959-24-5 appears in our catalog under these names: Indocyanine Green Impurity 2, (E)-N-((2E,4E)-5-(Phenylamino)penta-2,4-dien-1-ylidene)aniline hydrochloride 97%, (E)-N-((2E,4E)-5-(Phenylamino)penta-2,4-dien-1-ylidene)aniline hydrochloride, 97%, 97%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride (CAS 13959-24-5) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride. InChIKey: VUCMMJBDNXZQDJ-ZUJIUJENSA-N.
| Molecular formula | C17H17ClN2 |
|---|---|
| Molecular weight | 284.8 g/mol |
| IUPAC name | N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride |
| InChIKey | VUCMMJBDNXZQDJ-ZUJIUJENSA-N |
| SMILES | C1=CC=C(C=C1)N/C=C/C=C/C=NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)