CAS 1845716-92-8 is the registry number for 5,6-Dihdyro-6,6-dimethylindolo[1,2-a]quinoxaline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride (CAS 1845716-92-8) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: 6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride. InChIKey: ONVPCWLEXTWMSP-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2 |
|---|---|
| Molecular weight | 284.8 g/mol |
| IUPAC name | 6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride |
| InChIKey | ONVPCWLEXTWMSP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC3=CC=CC=C3N2C4=CC=CC=C4N1)C.Cl |
Computed by PubChem (NCBI)