Products 1845716-92-8

CAS 1845716-92-8 is the registry number for 5,6-Dihdyro-6,6-dimethylindolo[1,2-a]quinoxaline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride (CAS 1845716-92-8) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: 6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride. InChIKey: ONVPCWLEXTWMSP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17ClN2
Molecular weight284.8 g/mol
IUPAC name6,6-dimethyl-5H-indolo[1,2-a]quinoxaline;hydrochloride
InChIKeyONVPCWLEXTWMSP-UHFFFAOYSA-N
SMILESCC1(C2=CC3=CC=CC=C3N2C4=CC=CC=C4N1)C.Cl

Computed by PubChem (NCBI)