CAS 1497-49-0 appears in our catalog under these names: Glutacondianil Hydrochloride, N–(5–(Phenylamino)–2,4–pentadienylidene)aniline monohydrochloride, Glutaconic aldehyde dianilide hydrochloride, mixture of isom, N-(5-(Phenylamino)-2,4-pentadienylidene)aniline monohydrochloride, Glutaconaldehydedianil Hydrochloride, >98.0%(N). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 100g, 25g, 500g, 0,25kg, 0,5kg, 250g, 1kg.
N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride (CAS 1497-49-0) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride. InChIKey: VUCMMJBDNXZQDJ-ZUJIUJENSA-N.
| Molecular formula | C17H17ClN2 |
|---|---|
| Molecular weight | 284.8 g/mol |
| IUPAC name | N-[(1E,3E)-5-phenyliminopenta-1,3-dienyl]aniline;hydrochloride |
| InChIKey | VUCMMJBDNXZQDJ-ZUJIUJENSA-N |
| SMILES | C1=CC=C(C=C1)N/C=C/C=C/C=NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)