CAS 3574-01-4 appears in our catalog under these names: 1-Phenyl-2,3,4,9-tetrahydro-1h-pyrido[3,4-b]indole, 98%, 1-Phenyl-2,3,4,9-tetrahydro-1H-pyrido(3,4-b)indole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 3574-01-4) is a chemical compound with the molecular formula C17H17ClN2 and a molecular weight of 284.8 g/mol. IUPAC name: 1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: BPZCTJZLNJOUBQ-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2 |
|---|---|
| Molecular weight | 284.8 g/mol |
| IUPAC name | 1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | BPZCTJZLNJOUBQ-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C3=CC=CC=C3N2)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)