Products 1003707-16-1
CAS 1003707-16-1 is the registry number for 3-(4-Bromophenyl)-3-cyanopropanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(4-bromophenyl)-3-cyanopropanoic acid (CAS 1003707-16-1) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 3-(4-bromophenyl)-3-cyanopropanoic acid. InChIKey: AYOMFJWRKMHFBL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 3-(4-bromophenyl)-3-cyanopropanoic acid |
| InChIKey | AYOMFJWRKMHFBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)C#N)Br |
Computed by PubChem (NCBI)