CAS 1003946-73-3 is the registry number for Rel-benzyl ((1R,5S,6s)-3-azabicyclo[3.1.0]hexan-6-yl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (CAS 1003946-73-3) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: benzyl N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate. InChIKey: TWYYSSDOOYLSSO-FOSCPWQOSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | benzyl N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| InChIKey | TWYYSSDOOYLSSO-FOSCPWQOSA-N |
| SMILES | C1[C@@H]2[C@@H](C2NC(=O)OCC3=CC=CC=C3)CN1 |
Computed by PubChem (NCBI)