CAS 100397-96-4 appears in our catalog under these names: 1–(4–Bromophenyl)–2–(pyridin–4–yl)ethanone, 1-(4-Bromophenyl)-2-(pyridin-4-yl)ethanone, 97%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
1-(4-bromophenyl)-2-pyridin-4-ylethanone (CAS 100397-96-4) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: 1-(4-bromophenyl)-2-pyridin-4-ylethanone. InChIKey: NKFPGRBMSCKIBN-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-pyridin-4-ylethanone |
| InChIKey | NKFPGRBMSCKIBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC2=CC=NC=C2)Br |
Computed by PubChem (NCBI)