CAS 337932-29-3 appears in our catalog under these names: Cuspin-1, 95%, Cuspin-1, Cuspin–1, Cuspin 1. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 0,5g, 25 mg, 5 mg.
(5-bromo-3-pyridinyl)-(4-methylphenyl)methanone (CAS 337932-29-3) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: (5-bromo-3-pyridinyl)-(4-methylphenyl)methanone. InChIKey: AJZRSLVRFSCCIL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | (5-bromo-3-pyridinyl)-(4-methylphenyl)methanone |
| InChIKey | AJZRSLVRFSCCIL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)