CAS 6846-12-4 appears in our catalog under these names: 4–Bromo–N–phenylbenzamide, N-Phenyl 4-bromobenzamide, 98%, 4-Bromo-N-phenylbenzamide, 98%, N-Phenyl 4-bromobenzamide, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg.
4-bromo-N-phenylbenzamide (CAS 6846-12-4) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: 4-bromo-N-phenylbenzamide. InChIKey: QVTGXXQAVWWJRO-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 4-bromo-N-phenylbenzamide |
| InChIKey | QVTGXXQAVWWJRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)