CAS 845276-75-7 appears in our catalog under these names: Bromfenac Impurity 9, Bromfenac Impurity 2, (2-Aminophenyl)(2-bromophenyl)methanone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2-aminophenyl)-(2-bromophenyl)methanone (CAS 845276-75-7) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: (2-aminophenyl)-(2-bromophenyl)methanone. InChIKey: DPWZTVFFYVPPHU-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | (2-aminophenyl)-(2-bromophenyl)methanone |
| InChIKey | DPWZTVFFYVPPHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Br)N |
Computed by PubChem (NCBI)