CAS 1140-17-6 appears in our catalog under these names: 2–Amino–4′–bromobenzophenone, 2-Amino-4'-bromobenzophenone, >98.0%(T), (2-Aminophenyl)(4-bromophenyl)methanone 98%, 2-Amino-4'-bromobenzophenone. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
(2-aminophenyl)-(4-bromophenyl)methanone (CAS 1140-17-6) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: (2-aminophenyl)-(4-bromophenyl)methanone. InChIKey: WIISOMGJWLLMDG-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | (2-aminophenyl)-(4-bromophenyl)methanone |
| InChIKey | WIISOMGJWLLMDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)