Products 1004037-64-2
CAS 1004037-64-2 is the registry number for (E)-1-(2-bromophenyl)-3-(4-bromophenyl)prop-2-en-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-1-(2-bromophenyl)-3-(4-bromophenyl)prop-2-en-1-one (CAS 1004037-64-2) is a chemical compound with the molecular formula C15H10Br2O and a molecular weight of 366.05 g/mol. IUPAC name: (E)-1-(2-bromophenyl)-3-(4-bromophenyl)prop-2-en-1-one. InChIKey: LJWQMNLMKQCBSF-JXMROGBWSA-N.
| Molecular formula | C15H10Br2O |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | (E)-1-(2-bromophenyl)-3-(4-bromophenyl)prop-2-en-1-one |
| InChIKey | LJWQMNLMKQCBSF-JXMROGBWSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)/C=C/C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)