CAS 39654-52-9 appears in our catalog under these names: Cyclobenzaprine Impurity 3, 10,11-Dibromo10,11-dihydro-5-dibenzosuberenone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(9S,10S)-9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one (CAS 39654-52-9) is a chemical compound with the molecular formula C15H10Br2O and a molecular weight of 366.05 g/mol. IUPAC name: (9S,10S)-9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one. InChIKey: UXTYUOCJQGRAIG-KBPBESRZSA-N.
| Molecular formula | C15H10Br2O |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | (9S,10S)-9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one |
| InChIKey | UXTYUOCJQGRAIG-KBPBESRZSA-N |
| SMILES | C1=CC=C2C(=C1)[C@@H]([C@H](C3=CC=CC=C3C2=O)Br)Br |
Computed by PubChem (NCBI)