Products 226946-20-9
CAS 226946-20-9 is the registry number for 3,7-Dibromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 226946-20-9) is a chemical compound with the molecular formula C15H10Br2O and a molecular weight of 366.05 g/mol. IUPAC name: 5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: VUPDRYTXGYYYBO-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | 5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | VUPDRYTXGYYYBO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Br)C(=O)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)