CAS 126443-21-8 is the registry number for (E)-1,3-Bis(4-bromophenyl)prop-2-en-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-1,3-bis(4-bromophenyl)prop-2-en-1-one (CAS 126443-21-8) is a chemical compound with the molecular formula C15H10Br2O and a molecular weight of 366.05 g/mol. IUPAC name: (E)-1,3-bis(4-bromophenyl)prop-2-en-1-one. InChIKey: LRNSKEMAIABAKW-XCVCLJGOSA-N.
| Molecular formula | C15H10Br2O |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | (E)-1,3-bis(4-bromophenyl)prop-2-en-1-one |
| InChIKey | LRNSKEMAIABAKW-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)