CAS 57295-97-3 is the registry number for 10,11-Dibromo 5-Dibenzosuberenone. Offered by: TRC. Available pack sizes: 10g.
9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one (CAS 57295-97-3) is a chemical compound with the molecular formula C15H10Br2O and a molecular weight of 366.05 g/mol. IUPAC name: 9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one. InChIKey: UXTYUOCJQGRAIG-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O |
|---|---|
| Molecular weight | 366.05 g/mol |
| IUPAC name | 9,10-dibromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one |
| InChIKey | UXTYUOCJQGRAIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C3=CC=CC=C3C2=O)Br)Br |
Computed by PubChem (NCBI)