CAS 100414-80-0 appears in our catalog under these names: (4R)-4,6'-Dimethyl-4,5-dihydro-1'H,3H-spiro[furan-2,3'-naphtho[1,2-c]furan]-1'-one, 98%, Dan Shen spiroketal lactone, Danshinspiroketallactone. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
(4'R)-4',6-dimethylspiro[benzo[g][2]benzofuran-3,2'-oxolane]-1-one (CAS 100414-80-0) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: (4'R)-4',6-dimethylspiro[benzo[g][2]benzofuran-3,2'-oxolane]-1-one. InChIKey: DNLNYCCHXAULQA-YQDUUYOCSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (4'R)-4',6-dimethylspiro[benzo[g][2]benzofuran-3,2'-oxolane]-1-one |
| InChIKey | DNLNYCCHXAULQA-YQDUUYOCSA-N |
| SMILES | C[C@@H]1CC2(C3=C(C4=CC=CC(=C4C=C3)C)C(=O)O2)OC1 |
Computed by PubChem (NCBI)