Products 100414-81-1
CAS 100414-81-1 is the registry number for Conolidine. Offered by: Sigma-Aldrich. Available pack sizes: 25MG, 5MG.
(13S,14E)-14-ethylidene-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one (CAS 100414-81-1) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: (13S,14E)-14-ethylidene-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one. InChIKey: DBGBUYFOJXOYNY-RENATIMJSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | (13S,14E)-14-ethylidene-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraen-12-one |
| InChIKey | DBGBUYFOJXOYNY-RENATIMJSA-N |
| SMILES | C/C=C\1/CN2CC[C@@H]1C(=O)C3=C(C2)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)