Products 2654792-78-4
CAS 2654792-78-4 is the registry number for Ethyl 8-(trifluoromethyl)-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 8-(trifluoromethyl)-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxylate (CAS 2654792-78-4) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: ethyl 8-(trifluoromethyl)-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxylate. InChIKey: LOHPUXGMATWXSM-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | ethyl 8-(trifluoromethyl)-4,5-dihydro-1H-furo[2,3-g]indazole-7-carboxylate |
| InChIKey | LOHPUXGMATWXSM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)CCC3=C2NN=C3)C(F)(F)F |
Computed by PubChem (NCBI)