Products 100440-60-6

CAS 100440-60-6 is the registry number for 1-Benzyl-5-chloro-1h-1,3-benzodiazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

3-benzyl-6-chloro-1H-benzimidazole-2-thione (CAS 100440-60-6) is a chemical compound with the molecular formula C14H11ClN2S and a molecular weight of 274.8 g/mol. IUPAC name: 3-benzyl-6-chloro-1H-benzimidazole-2-thione. InChIKey: OUPMSORROMFUIY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClN2S
Molecular weight274.8 g/mol
IUPAC name3-benzyl-6-chloro-1H-benzimidazole-2-thione
InChIKeyOUPMSORROMFUIY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)NC2=S

Computed by PubChem (NCBI)