CAS 83548-60-1 appears in our catalog under these names: 4-Chloro-5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidine, 95%, 4-Chloro-5,6-dimethyl-2-phenylthieno(2,3-d)pyrimidine, 97%, 4-Chloro-5,6-dimethyl-2-phenylthieno(2,3-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-chloro-5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidine (CAS 83548-60-1) is a chemical compound with the molecular formula C14H11ClN2S and a molecular weight of 274.8 g/mol. IUPAC name: 4-chloro-5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidine. InChIKey: FEPVLPABTTUIHK-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2S |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 4-chloro-5,6-dimethyl-2-phenylthieno[2,3-d]pyrimidine |
| InChIKey | FEPVLPABTTUIHK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC(=N2)C3=CC=CC=C3)Cl)C |
Computed by PubChem (NCBI)