CAS 61249-37-4 appears in our catalog under these names: N-Benzyl-6-chloro-1,3-benzothiazol-2-amine, 95%, N-Benzyl-6-chlorobenzo(D)thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
N-benzyl-6-chloro-1,3-benzothiazol-2-amine (CAS 61249-37-4) is a chemical compound with the molecular formula C14H11ClN2S and a molecular weight of 274.8 g/mol. IUPAC name: N-benzyl-6-chloro-1,3-benzothiazol-2-amine. InChIKey: FGUYDZANGPMTNM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2S |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | N-benzyl-6-chloro-1,3-benzothiazol-2-amine |
| InChIKey | FGUYDZANGPMTNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC3=C(S2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)