CAS 1467309-43-8 is the registry number for 3-((7-Chloro-1,3-benzothiazol-2-yl)methyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(7-chloro-1,3-benzothiazol-2-yl)methyl]aniline (CAS 1467309-43-8) is a chemical compound with the molecular formula C14H11ClN2S and a molecular weight of 274.8 g/mol. IUPAC name: 3-[(7-chloro-1,3-benzothiazol-2-yl)methyl]aniline. InChIKey: MYJVYSWULDIQNC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2S |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 3-[(7-chloro-1,3-benzothiazol-2-yl)methyl]aniline |
| InChIKey | MYJVYSWULDIQNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CC2=NC3=C(S2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)