Products 2088517-91-1
CAS 2088517-91-1 is the registry number for 2-Chloro-3-(2-methylpyridin-3-yl)benzo[b]thiophen-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-(2-methyl-3-pyridinyl)-1-benzothiophen-5-amine (CAS 2088517-91-1) is a chemical compound with the molecular formula C14H11ClN2S and a molecular weight of 274.8 g/mol. IUPAC name: 2-chloro-3-(2-methyl-3-pyridinyl)-1-benzothiophen-5-amine. InChIKey: OVNJAIIJFRQTTR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2S |
|---|---|
| Molecular weight | 274.8 g/mol |
| IUPAC name | 2-chloro-3-(2-methyl-3-pyridinyl)-1-benzothiophen-5-amine |
| InChIKey | OVNJAIIJFRQTTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)C2=C(SC3=C2C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)